C27H22ClN5O — CID 118463490
2-(2-chlorophenyl)-N-(3-imidazol-1-ylpropyl)-3-phenylquinoxaline-6-carboxamide (PubChem CID 118463490) has the molecular formula C27H22ClN5O and a molecular weight of 467.96 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-(3-imidazol-1-ylpropyl)-3-phenylquinoxaline-6-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-N-(3-imidazol-1-ylpropyl)-3-phenylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 118463490 |
| Molecular Formula | C27H22ClN5O |
| Molecular Weight | 467.96 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 2-(2-chlorophenyl)-N-(3-imidazol-1-ylpropyl)-3-phenylquinoxaline-6-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)c1ccc2nc(-c3ccccc3Cl)c(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C27H22ClN5O/c28-22-10-5-4-9-21(22)26-25(19-7-2-1-3-8-19)32-24-17-20(11-12-23(24)31-26)27(34)30-13-6-15-33-16-14-29-18-33/h1-5,7-12,14,16-18H,6,13,15H2,(H,30,34) |
| InChIKey | RGQCTNJZXGKUDB-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.96 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|