C29H27N5O3 — CID 118463545
3-(3,5-dimethoxyphenyl)-N-(3-imidazol-1-ylpropyl)-2-phenylquinoxaline-6-carboxamide (PubChem CID 118463545) has the molecular formula C29H27N5O3 and a molecular weight of 493.57 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-N-(3-imidazol-1-ylpropyl)-2-phenylquinoxaline-6-carboxamide.
| Compound Name | 3-(3,5-dimethoxyphenyl)-N-(3-imidazol-1-ylpropyl)-2-phenylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 118463545 |
| Molecular Formula | C29H27N5O3 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-N-(3-imidazol-1-ylpropyl)-2-phenylquinoxaline-6-carboxamide |
| SMILES | COc1cc(OC)cc(-c2nc3cc(C(=O)NCCCn4ccnc4)ccc3nc2-c2ccccc2)c1 |
| InChI | InChI=1S/C29H27N5O3/c1-36-23-15-22(16-24(18-23)37-2)28-27(20-7-4-3-5-8-20)32-25-10-9-21(17-26(25)33-28)29(35)31-11-6-13-34-14-12-30-19-34/h3-5,7-10,12,14-19H,6,11,13H2,1-2H3,(H,31,35) |
| InChIKey | KQLCTZHMKAWIOJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|