C28H22N6O — CID 118463951
3-(3-cyanophenyl)-N-(3-imidazol-1-ylpropyl)-2-phenylquinoxaline-6-carboxamide (PubChem CID 118463951) has the molecular formula C28H22N6O and a molecular weight of 458.53 g/mol. Its IUPAC name is 3-(3-cyanophenyl)-N-(3-imidazol-1-ylpropyl)-2-phenylquinoxaline-6-carboxamide.
| Compound Name | 3-(3-cyanophenyl)-N-(3-imidazol-1-ylpropyl)-2-phenylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 118463951 |
| Molecular Formula | C28H22N6O |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 3-(3-cyanophenyl)-N-(3-imidazol-1-ylpropyl)-2-phenylquinoxaline-6-carboxamide |
| SMILES | N#Cc1cccc(-c2nc3cc(C(=O)NCCCn4ccnc4)ccc3nc2-c2ccccc2)c1 |
| InChI | InChI=1S/C28H22N6O/c29-18-20-6-4-9-22(16-20)27-26(21-7-2-1-3-8-21)32-24-11-10-23(17-25(24)33-27)28(35)31-12-5-14-34-15-13-30-19-34/h1-4,6-11,13,15-17,19H,5,12,14H2,(H,31,35) |
| InChIKey | SJELFPXUORKMBP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|