C29H33N7O2 — CID 118463624
N-(3-imidazol-1-ylpropyl)-2-(3-morpholin-4-ylpyrrolidin-1-yl)-3-phenylquinoxaline-6-carboxamide (PubChem CID 118463624) has the molecular formula C29H33N7O2 and a molecular weight of 511.63 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-2-(3-morpholin-4-ylpyrrolidin-1-yl)-3-phenylquinoxaline-6-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-2-(3-morpholin-4-ylpyrrolidin-1-yl)-3-phenylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 118463624 |
| Molecular Formula | C29H33N7O2 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-2-(3-morpholin-4-ylpyrrolidin-1-yl)-3-phenylquinoxaline-6-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)c1ccc2nc(N3CCC(N4CCOCC4)C3)c(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C29H33N7O2/c37-29(31-10-4-12-34-14-11-30-21-34)23-7-8-25-26(19-23)32-27(22-5-2-1-3-6-22)28(33-25)36-13-9-24(20-36)35-15-17-38-18-16-35/h1-3,5-8,11,14,19,21,24H,4,9-10,12-13,15-18,20H2,(H,31,37) |
| InChIKey | JTZHLMUTJNZOGN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|