C29H26N4O3S — CID 159480935
5-imidazol-1-yl-1-[2-(3-methylsulfonylphenyl)-3-phenylquinoxalin-6-yl]pentan-1-one (PubChem CID 159480935) has the molecular formula C29H26N4O3S and a molecular weight of 510.62 g/mol. Its IUPAC name is 5-imidazol-1-yl-1-[2-(3-methylsulfonylphenyl)-3-phenylquinoxalin-6-yl]pentan-1-one.
| Compound Name | 5-imidazol-1-yl-1-[2-(3-methylsulfonylphenyl)-3-phenylquinoxalin-6-yl]pentan-1-one |
|---|---|
| PubChem CID | 159480935 |
| Molecular Formula | C29H26N4O3S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | 5-imidazol-1-yl-1-[2-(3-methylsulfonylphenyl)-3-phenylquinoxalin-6-yl]pentan-1-one |
| SMILES | CS(=O)(=O)c1cccc(-c2nc3ccc(C(=O)CCCCn4ccnc4)cc3nc2-c2ccccc2)c1 |
| InChI | InChI=1S/C29H26N4O3S/c1-37(35,36)24-11-7-10-23(18-24)29-28(21-8-3-2-4-9-21)32-26-19-22(13-14-25(26)31-29)27(34)12-5-6-16-33-17-15-30-20-33/h2-4,7-11,13-15,17-20H,5-6,12,16H2,1H3 |
| InChIKey | LWZMCCYNHKGMMX-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 94.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|