C33H32N4O3 — CID 149391836
ethyl 3-[4-[7-(5-imidazol-1-ylpentanoyl)-3-phenylquinoxalin-2-yl]phenyl]propanoate (PubChem CID 149391836) has the molecular formula C33H32N4O3 and a molecular weight of 532.64 g/mol. Its IUPAC name is ethyl 3-[4-[7-(5-imidazol-1-ylpentanoyl)-3-phenylquinoxalin-2-yl]phenyl]propanoate.
| Compound Name | ethyl 3-[4-[7-(5-imidazol-1-ylpentanoyl)-3-phenylquinoxalin-2-yl]phenyl]propanoate |
|---|---|
| PubChem CID | 149391836 |
| Molecular Formula | C33H32N4O3 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | ethyl 3-[4-[7-(5-imidazol-1-ylpentanoyl)-3-phenylquinoxalin-2-yl]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(-c2nc3cc(C(=O)CCCCn4ccnc4)ccc3nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H32N4O3/c1-2-40-31(39)18-13-24-11-14-26(15-12-24)33-32(25-8-4-3-5-9-25)35-28-17-16-27(22-29(28)36-33)30(38)10-6-7-20-37-21-19-34-23-37/h3-5,8-9,11-12,14-17,19,21-23H,2,6-7,10,13,18,20H2,1H3 |
| InChIKey | YNRJKLZVSWOIAI-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|