C15H17F3N4O — CID 21467438
2-[(E)-[3-imidazol-1-yl-1-[4-(trifluoromethyl)phenyl]propylidene]amino]oxyethanamine (PubChem CID 21467438) has the molecular formula C15H17F3N4O and a molecular weight of 326.32 g/mol. Its IUPAC name is 2-[(E)-[3-imidazol-1-yl-1-[4-(trifluoromethyl)phenyl]propylidene]amino]oxyethanamine.
| Compound Name | 2-[(E)-[3-imidazol-1-yl-1-[4-(trifluoromethyl)phenyl]propylidene]amino]oxyethanamine |
|---|---|
| PubChem CID | 21467438 |
| Molecular Formula | C15H17F3N4O |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 2-[(E)-[3-imidazol-1-yl-1-[4-(trifluoromethyl)phenyl]propylidene]amino]oxyethanamine |
| SMILES | NCCO/N=C(\CCn1ccnc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H17F3N4O/c16-15(17,18)13-3-1-12(2-4-13)14(21-23-10-6-19)5-8-22-9-7-20-11-22/h1-4,7,9,11H,5-6,8,10,19H2/b21-14+ |
| InChIKey | PJQHGVRTVASOOW-KGENOOAVSA-N |
| XLogP | 2.67 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|