C16H19Cl2NO3 — CID 75083508
cyclopentyl 4-(3,4-dichlorophenyl)-4-methoxyiminobutanoate (PubChem CID 75083508) has the molecular formula C16H19Cl2NO3 and a molecular weight of 344.24 g/mol. Its IUPAC name is cyclopentyl 4-(3,4-dichlorophenyl)-4-methoxyiminobutanoate.
| Compound Name | cyclopentyl 4-(3,4-dichlorophenyl)-4-methoxyiminobutanoate |
|---|---|
| PubChem CID | 75083508 |
| Molecular Formula | C16H19Cl2NO3 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | cyclopentyl 4-(3,4-dichlorophenyl)-4-methoxyiminobutanoate |
| SMILES | CON=C(CCC(=O)OC1CCCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H19Cl2NO3/c1-21-19-15(11-6-7-13(17)14(18)10-11)8-9-16(20)22-12-4-2-3-5-12/h6-7,10,12H,2-5,8-9H2,1H3 |
| InChIKey | AQIMYHBGARIDPQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|