C15H19Cl2N3O2 — CID 45101407
(4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-N-pyrrolidin-3-ylbutanamide (PubChem CID 45101407) has the molecular formula C15H19Cl2N3O2 and a molecular weight of 344.24 g/mol. Its IUPAC name is (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-N-pyrrolidin-3-ylbutanamide.
| Compound Name | (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-N-pyrrolidin-3-ylbutanamide |
|---|---|
| PubChem CID | 45101407 |
| Molecular Formula | C15H19Cl2N3O2 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | (4Z)-4-(3,4-dichlorophenyl)-4-methoxyimino-N-pyrrolidin-3-ylbutanamide |
| SMILES | CO/N=C(/CCC(=O)NC1CCNC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H19Cl2N3O2/c1-22-20-14(10-2-3-12(16)13(17)8-10)4-5-15(21)19-11-6-7-18-9-11/h2-3,8,11,18H,4-7,9H2,1H3,(H,19,21)/b20-14- |
| InChIKey | APDZQSQCDJCWMN-ZHZULCJRSA-N |
| XLogP | 2.60 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|