C15H21Cl3N2O — CID 119388493
4-(3,4-dichlorophenyl)-N-piperidin-4-ylbutanamide;hydrochloride (PubChem CID 119388493) has the molecular formula C15H21Cl3N2O and a molecular weight of 351.71 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-N-piperidin-4-ylbutanamide;hydrochloride.
| Compound Name | 4-(3,4-dichlorophenyl)-N-piperidin-4-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119388493 |
| Molecular Formula | C15H21Cl3N2O |
| Molecular Weight | 351.71 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-N-piperidin-4-ylbutanamide;hydrochloride |
| SMILES | Cl.O=C(CCCc1ccc(Cl)c(Cl)c1)NC1CCNCC1 |
| InChI | InChI=1S/C15H20Cl2N2O.ClH/c16-13-5-4-11(10-14(13)17)2-1-3-15(20)19-12-6-8-18-9-7-12;/h4-5,10,12,18H,1-3,6-9H2,(H,19,20);1H |
| InChIKey | TUSMAWZXKGWYBM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.71 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |