C17H21Cl2NO3 — CID 119229226
4-[4-(3,4-dichlorophenyl)butanoylamino]cyclohexane-1-carboxylic acid (PubChem CID 119229226) has the molecular formula C17H21Cl2NO3 and a molecular weight of 358.27 g/mol. Its IUPAC name is 4-[4-(3,4-dichlorophenyl)butanoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-(3,4-dichlorophenyl)butanoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 119229226 |
| Molecular Formula | C17H21Cl2NO3 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 4-[4-(3,4-dichlorophenyl)butanoylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(CCCc1ccc(Cl)c(Cl)c1)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C17H21Cl2NO3/c18-14-9-4-11(10-15(14)19)2-1-3-16(21)20-13-7-5-12(6-8-13)17(22)23/h4,9-10,12-13H,1-3,5-8H2,(H,20,21)(H,22,23) |
| InChIKey | HYPMOPCWSHUUEF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |