C17H18Cl2N4O2 — CID 75083596
4-(3,4-dichlorophenyl)-N-(3,5-dimethylpyrazin-2-yl)-4-methoxyiminobutanamide (PubChem CID 75083596) has the molecular formula C17H18Cl2N4O2 and a molecular weight of 381.26 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-N-(3,5-dimethylpyrazin-2-yl)-4-methoxyiminobutanamide.
| Compound Name | 4-(3,4-dichlorophenyl)-N-(3,5-dimethylpyrazin-2-yl)-4-methoxyiminobutanamide |
|---|---|
| PubChem CID | 75083596 |
| Molecular Formula | C17H18Cl2N4O2 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-N-(3,5-dimethylpyrazin-2-yl)-4-methoxyiminobutanamide |
| SMILES | CON=C(CCC(=O)Nc1ncc(C)nc1C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H18Cl2N4O2/c1-10-9-20-17(11(2)21-10)22-16(24)7-6-15(23-25-3)12-4-5-13(18)14(19)8-12/h4-5,8-9H,6-7H2,1-3H3,(H,20,22,24) |
| InChIKey | SLWWZZOQXUZCEO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|