C19H20Cl2N2O2 — CID 58436802
(5E)-5-(3,4-dichlorophenyl)-1-(2,4-dimethyl-3-pyridinyl)-5-methoxyiminopentan-2-one (PubChem CID 58436802) has the molecular formula C19H20Cl2N2O2 and a molecular weight of 379.29 g/mol. Its IUPAC name is (5E)-5-(3,4-dichlorophenyl)-1-(2,4-dimethyl-3-pyridinyl)-5-methoxyiminopentan-2-one.
| Compound Name | (5E)-5-(3,4-dichlorophenyl)-1-(2,4-dimethyl-3-pyridinyl)-5-methoxyiminopentan-2-one |
|---|---|
| PubChem CID | 58436802 |
| Molecular Formula | C19H20Cl2N2O2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | (5E)-5-(3,4-dichlorophenyl)-1-(2,4-dimethyl-3-pyridinyl)-5-methoxyiminopentan-2-one |
| SMILES | CO/N=C(\CCC(=O)Cc1c(C)ccnc1C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H20Cl2N2O2/c1-12-8-9-22-13(2)16(12)11-15(24)5-7-19(23-25-3)14-4-6-17(20)18(21)10-14/h4,6,8-10H,5,7,11H2,1-3H3/b23-19+ |
| InChIKey | CNUQELBJPAJDPC-FCDQGJHFSA-N |
| XLogP | 4.95 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|