C15H15Cl2N3O3S — CID 58436871
N-[(3E)-3-(3,4-dichlorophenyl)-3-methoxyiminopropyl]pyridine-3-sulfonamide (PubChem CID 58436871) has the molecular formula C15H15Cl2N3O3S and a molecular weight of 388.28 g/mol. Its IUPAC name is N-[(3E)-3-(3,4-dichlorophenyl)-3-methoxyiminopropyl]pyridine-3-sulfonamide.
| Compound Name | N-[(3E)-3-(3,4-dichlorophenyl)-3-methoxyiminopropyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 58436871 |
| Molecular Formula | C15H15Cl2N3O3S |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | N-[(3E)-3-(3,4-dichlorophenyl)-3-methoxyiminopropyl]pyridine-3-sulfonamide |
| SMILES | CO/N=C(\CCNS(=O)(=O)c1cccnc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H15Cl2N3O3S/c1-23-20-15(11-4-5-13(16)14(17)9-11)6-8-19-24(21,22)12-3-2-7-18-10-12/h2-5,7,9-10,19H,6,8H2,1H3/b20-15+ |
| InChIKey | AUKKTNKQXYISPS-HMMYKYKNSA-N |
| XLogP | 3.11 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|