C12H12ClN3O4S — CID 140673297
N-(3-chloro-5,6-dimethoxy-2-pyridinyl)pyridine-3-sulfonamide (PubChem CID 140673297) has the molecular formula C12H12ClN3O4S and a molecular weight of 329.77 g/mol. Its IUPAC name is N-(3-chloro-5,6-dimethoxy-2-pyridinyl)pyridine-3-sulfonamide.
| Compound Name | N-(3-chloro-5,6-dimethoxy-2-pyridinyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 140673297 |
| Molecular Formula | C12H12ClN3O4S |
| Molecular Weight | 329.77 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | N-(3-chloro-5,6-dimethoxy-2-pyridinyl)pyridine-3-sulfonamide |
| SMILES | COc1cc(Cl)c(NS(=O)(=O)c2cccnc2)nc1OC |
| InChI | InChI=1S/C12H12ClN3O4S/c1-19-10-6-9(13)11(15-12(10)20-2)16-21(17,18)8-4-3-5-14-7-8/h3-7H,1-2H3,(H,15,16) |
| InChIKey | DDTMURPTMVDCSX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.77 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |