C13H14N4O3S — CID 107469946
3-methoxy-2-(pyridin-3-ylsulfonylamino)benzenecarboximidamide (PubChem CID 107469946) has the molecular formula C13H14N4O3S and a molecular weight of 306.35 g/mol. Its IUPAC name is 3-methoxy-2-(pyridin-3-ylsulfonylamino)benzenecarboximidamide.
| Compound Name | 3-methoxy-2-(pyridin-3-ylsulfonylamino)benzenecarboximidamide |
|---|---|
| PubChem CID | 107469946 |
| Molecular Formula | C13H14N4O3S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 3-methoxy-2-(pyridin-3-ylsulfonylamino)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(OC)c1NS(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C13H14N4O3S/c1-20-11-6-2-5-10(13(14)15)12(11)17-21(18,19)9-4-3-7-16-8-9/h2-8,17H,1H3,(H3,14,15) |
| InChIKey | YTZGGOKRJQPYTP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 118.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|