C12H16N4O2 — CID 107469918
1-(2-carbamimidoyl-6-methoxyphenyl)-3-cyclopropylurea (PubChem CID 107469918) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 1-(2-carbamimidoyl-6-methoxyphenyl)-3-cyclopropylurea.
| Compound Name | 1-(2-carbamimidoyl-6-methoxyphenyl)-3-cyclopropylurea |
|---|---|
| PubChem CID | 107469918 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1-(2-carbamimidoyl-6-methoxyphenyl)-3-cyclopropylurea |
| SMILES | [H]/N=C(\N)c1cccc(OC)c1NC(=O)NC1CC1 |
| InChI | InChI=1S/C12H16N4O2/c1-18-9-4-2-3-8(11(13)14)10(9)16-12(17)15-7-5-6-7/h2-4,7H,5-6H2,1H3,(H3,13,14)(H2,15,16,17) |
| InChIKey | BHGZWWZVECRQNP-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 100.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|