C13H8Cl2N4O2S — CID 142780141
N-(3,6-dichloroquinoxalin-2-yl)pyridine-3-sulfonamide (PubChem CID 142780141) has the molecular formula C13H8Cl2N4O2S and a molecular weight of 355.21 g/mol. Its IUPAC name is N-(3,6-dichloroquinoxalin-2-yl)pyridine-3-sulfonamide.
| Compound Name | N-(3,6-dichloroquinoxalin-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 142780141 |
| Molecular Formula | C13H8Cl2N4O2S |
| Molecular Weight | 355.21 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | N-(3,6-dichloroquinoxalin-2-yl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1nc2ccc(Cl)cc2nc1Cl)c1cccnc1 |
| InChI | InChI=1S/C13H8Cl2N4O2S/c14-8-3-4-10-11(6-8)17-12(15)13(18-10)19-22(20,21)9-2-1-5-16-7-9/h1-7H,(H,18,19) |
| InChIKey | UETOXMWSIVRWIQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.21 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |