C14H12ClN3O2S — CID 81279894
N-[2-(3-aminoprop-1-ynyl)-4-chlorophenyl]pyridine-3-sulfonamide (PubChem CID 81279894) has the molecular formula C14H12ClN3O2S and a molecular weight of 321.79 g/mol. Its IUPAC name is N-[2-(3-aminoprop-1-ynyl)-4-chlorophenyl]pyridine-3-sulfonamide.
| Compound Name | N-[2-(3-aminoprop-1-ynyl)-4-chlorophenyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 81279894 |
| Molecular Formula | C14H12ClN3O2S |
| Molecular Weight | 321.79 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | N-[2-(3-aminoprop-1-ynyl)-4-chlorophenyl]pyridine-3-sulfonamide |
| SMILES | NCC#Cc1cc(Cl)ccc1NS(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C14H12ClN3O2S/c15-12-5-6-14(11(9-12)3-1-7-16)18-21(19,20)13-4-2-8-17-10-13/h2,4-6,8-10,18H,7,16H2 |
| InChIKey | TZMWRUYOFSAICM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.79 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|