C14H12FN3O2S — CID 60815124
N-[2-(3-aminoprop-1-ynyl)-4-fluorophenyl]pyridine-3-sulfonamide (PubChem CID 60815124) has the molecular formula C14H12FN3O2S and a molecular weight of 305.33 g/mol. Its IUPAC name is N-[2-(3-aminoprop-1-ynyl)-4-fluorophenyl]pyridine-3-sulfonamide.
| Compound Name | N-[2-(3-aminoprop-1-ynyl)-4-fluorophenyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 60815124 |
| Molecular Formula | C14H12FN3O2S |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | N-[2-(3-aminoprop-1-ynyl)-4-fluorophenyl]pyridine-3-sulfonamide |
| SMILES | NCC#Cc1cc(F)ccc1NS(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C14H12FN3O2S/c15-12-5-6-14(11(9-12)3-1-7-16)18-21(19,20)13-4-2-8-17-10-13/h2,4-6,8-10,18H,7,16H2 |
| InChIKey | OVMHIYGEXLNRQK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|