C12H11FN4O2S — CID 102693792
N-[2-(3-aminoprop-1-ynyl)-4-fluorophenyl]-1H-pyrazole-5-sulfonamide (PubChem CID 102693792) has the molecular formula C12H11FN4O2S and a molecular weight of 294.31 g/mol. Its IUPAC name is N-[2-(3-aminoprop-1-ynyl)-4-fluorophenyl]-1H-pyrazole-5-sulfonamide.
| Compound Name | N-[2-(3-aminoprop-1-ynyl)-4-fluorophenyl]-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102693792 |
| Molecular Formula | C12H11FN4O2S |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | N-[2-(3-aminoprop-1-ynyl)-4-fluorophenyl]-1H-pyrazole-5-sulfonamide |
| SMILES | NCC#Cc1cc(F)ccc1NS(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C12H11FN4O2S/c13-10-3-4-11(9(8-10)2-1-6-14)17-20(18,19)12-5-7-15-16-12/h3-5,7-8,17H,6,14H2,(H,15,16) |
| InChIKey | YXWXRFAQAOLNQC-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|