C11H11FN2O2 — CID 60814781
methyl N-[2-(3-aminoprop-1-ynyl)-4-fluorophenyl]carbamate (PubChem CID 60814781) has the molecular formula C11H11FN2O2 and a molecular weight of 222.22 g/mol. Its IUPAC name is methyl N-[2-(3-aminoprop-1-ynyl)-4-fluorophenyl]carbamate.
| Compound Name | methyl N-[2-(3-aminoprop-1-ynyl)-4-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 60814781 |
| Molecular Formula | C11H11FN2O2 |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | methyl N-[2-(3-aminoprop-1-ynyl)-4-fluorophenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(F)cc1C#CCN |
| InChI | InChI=1S/C11H11FN2O2/c1-16-11(15)14-10-5-4-9(12)7-8(10)3-2-6-13/h4-5,7H,6,13H2,1H3,(H,14,15) |
| InChIKey | BHYUEBXEAPAJGG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|