C17H22FNO2 — CID 166437697
tert-butyl N-(4-fluoro-2-hex-1-ynylphenyl)carbamate (PubChem CID 166437697) has the molecular formula C17H22FNO2 and a molecular weight of 291.37 g/mol. Its IUPAC name is tert-butyl N-(4-fluoro-2-hex-1-ynylphenyl)carbamate.
| Compound Name | tert-butyl N-(4-fluoro-2-hex-1-ynylphenyl)carbamate |
|---|---|
| PubChem CID | 166437697 |
| Molecular Formula | C17H22FNO2 |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | tert-butyl N-(4-fluoro-2-hex-1-ynylphenyl)carbamate |
| SMILES | CCCCC#Cc1cc(F)ccc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H22FNO2/c1-5-6-7-8-9-13-12-14(18)10-11-15(13)19-16(20)21-17(2,3)4/h10-12H,5-7H2,1-4H3,(H,19,20) |
| InChIKey | QABMMSIFJBTRHN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|