C16H25NO3 — CID 140675962
tert-butyl N-(4-butoxy-2-methylphenyl)carbamate (PubChem CID 140675962) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is tert-butyl N-(4-butoxy-2-methylphenyl)carbamate.
| Compound Name | tert-butyl N-(4-butoxy-2-methylphenyl)carbamate |
|---|---|
| PubChem CID | 140675962 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | tert-butyl N-(4-butoxy-2-methylphenyl)carbamate |
| SMILES | CCCCOc1ccc(NC(=O)OC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C16H25NO3/c1-6-7-10-19-13-8-9-14(12(2)11-13)17-15(18)20-16(3,4)5/h8-9,11H,6-7,10H2,1-5H3,(H,17,18) |
| InChIKey | UNFFMZJVWQEMOZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|