C16H24N2O5 — CID 122077403
3-[(4-butoxy-2-methylphenyl)carbamoylamino]-2-hydroxy-2-methylpropanoic acid (PubChem CID 122077403) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is 3-[(4-butoxy-2-methylphenyl)carbamoylamino]-2-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-[(4-butoxy-2-methylphenyl)carbamoylamino]-2-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122077403 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 3-[(4-butoxy-2-methylphenyl)carbamoylamino]-2-hydroxy-2-methylpropanoic acid |
| SMILES | CCCCOc1ccc(NC(=O)NCC(C)(O)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C16H24N2O5/c1-4-5-8-23-12-6-7-13(11(2)9-12)18-15(21)17-10-16(3,22)14(19)20/h6-7,9,22H,4-5,8,10H2,1-3H3,(H,19,20)(H2,17,18,21) |
| InChIKey | TYGUHAQYTUULAN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|