C17H25NO4 — CID 119133688
4-(4-butoxy-2-methylanilino)-2,2-dimethyl-4-oxobutanoic acid (PubChem CID 119133688) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is 4-(4-butoxy-2-methylanilino)-2,2-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-(4-butoxy-2-methylanilino)-2,2-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 119133688 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 4-(4-butoxy-2-methylanilino)-2,2-dimethyl-4-oxobutanoic acid |
| SMILES | CCCCOc1ccc(NC(=O)CC(C)(C)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C17H25NO4/c1-5-6-9-22-13-7-8-14(12(2)10-13)18-15(19)11-17(3,4)16(20)21/h7-8,10H,5-6,9,11H2,1-4H3,(H,18,19)(H,20,21) |
| InChIKey | OSGQNBMJDBJJPN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|