C15H20F3NO3 — CID 87043030
N-(4-butoxy-2-methylphenyl)-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 87043030) has the molecular formula C15H20F3NO3 and a molecular weight of 319.32 g/mol. Its IUPAC name is N-(4-butoxy-2-methylphenyl)-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-(4-butoxy-2-methylphenyl)-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 87043030 |
| Molecular Formula | C15H20F3NO3 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-(4-butoxy-2-methylphenyl)-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | CCCCOc1ccc(NC(=O)COCC(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C15H20F3NO3/c1-3-4-7-22-12-5-6-13(11(2)8-12)19-14(20)9-21-10-15(16,17)18/h5-6,8H,3-4,7,9-10H2,1-2H3,(H,19,20) |
| InChIKey | SOKKXKIBQLJONH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|