C11H11ClF3NO3 — CID 86847323
N-(2-chloro-5-methoxyphenyl)-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 86847323) has the molecular formula C11H11ClF3NO3 and a molecular weight of 297.66 g/mol. Its IUPAC name is N-(2-chloro-5-methoxyphenyl)-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-(2-chloro-5-methoxyphenyl)-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 86847323 |
| Molecular Formula | C11H11ClF3NO3 |
| Molecular Weight | 297.66 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | N-(2-chloro-5-methoxyphenyl)-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | COc1ccc(Cl)c(NC(=O)COCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H11ClF3NO3/c1-18-7-2-3-8(12)9(4-7)16-10(17)5-19-6-11(13,14)15/h2-4H,5-6H2,1H3,(H,16,17) |
| InChIKey | JIFBWAPACHMMDJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.66 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |