C11H11ClF3NO2 — CID 86915349
N-(3-chloro-2-methylphenyl)-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 86915349) has the molecular formula C11H11ClF3NO2 and a molecular weight of 281.66 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 86915349 |
| Molecular Formula | C11H11ClF3NO2 |
| Molecular Weight | 281.66 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)COCC(F)(F)F |
| InChI | InChI=1S/C11H11ClF3NO2/c1-7-8(12)3-2-4-9(7)16-10(17)5-18-6-11(13,14)15/h2-4H,5-6H2,1H3,(H,16,17) |
| InChIKey | DCURSYAZANCGOJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.66 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |