C11H11F3INO2 — CID 113368783
N-(3-iodo-2-methylphenyl)-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 113368783) has the molecular formula C11H11F3INO2 and a molecular weight of 373.11 g/mol. Its IUPAC name is N-(3-iodo-2-methylphenyl)-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-(3-iodo-2-methylphenyl)-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 113368783 |
| Molecular Formula | C11H11F3INO2 |
| Molecular Weight | 373.11 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | N-(3-iodo-2-methylphenyl)-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | Cc1c(I)cccc1NC(=O)COCC(F)(F)F |
| InChI | InChI=1S/C11H11F3INO2/c1-7-8(15)3-2-4-9(7)16-10(17)5-18-6-11(12,13)14/h2-4H,5-6H2,1H3,(H,16,17) |
| InChIKey | YAIKPVYIMHNLGN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.11 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|