C11H11ClF4N2O2 — CID 43376874
N-(5-amino-2-chlorophenyl)-2-(2,2,3,3-tetrafluoropropoxy)acetamide (PubChem CID 43376874) has the molecular formula C11H11ClF4N2O2 and a molecular weight of 314.67 g/mol. Its IUPAC name is N-(5-amino-2-chlorophenyl)-2-(2,2,3,3-tetrafluoropropoxy)acetamide.
| Compound Name | N-(5-amino-2-chlorophenyl)-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
|---|---|
| PubChem CID | 43376874 |
| Molecular Formula | C11H11ClF4N2O2 |
| Molecular Weight | 314.67 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | N-(5-amino-2-chlorophenyl)-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
| SMILES | Nc1ccc(Cl)c(NC(=O)COCC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C11H11ClF4N2O2/c12-7-2-1-6(17)3-8(7)18-9(19)4-20-5-11(15,16)10(13)14/h1-3,10H,4-5,17H2,(H,18,19) |
| InChIKey | YFQMAPLARQUXAX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.67 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|