C12H10ClF5O2 — CID 103473693
1-(2-chloro-5-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one (PubChem CID 103473693) has the molecular formula C12H10ClF5O2 and a molecular weight of 316.65 g/mol. Its IUPAC name is 1-(2-chloro-5-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one.
| Compound Name | 1-(2-chloro-5-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one |
|---|---|
| PubChem CID | 103473693 |
| Molecular Formula | C12H10ClF5O2 |
| Molecular Weight | 316.65 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 1-(2-chloro-5-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one |
| SMILES | O=C(COCC(F)(F)C(F)F)Cc1cc(F)ccc1Cl |
| InChI | InChI=1S/C12H10ClF5O2/c13-10-2-1-8(14)3-7(10)4-9(19)5-20-6-12(17,18)11(15)16/h1-3,11H,4-6H2 |
| InChIKey | VMJCCHZQZDQSHF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.65 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|