C12H12ClF5O2 — CID 103473957
1-(2-chloro-4-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol (PubChem CID 103473957) has the molecular formula C12H12ClF5O2 and a molecular weight of 318.67 g/mol. Its IUPAC name is 1-(2-chloro-4-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol.
| Compound Name | 1-(2-chloro-4-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol |
|---|---|
| PubChem CID | 103473957 |
| Molecular Formula | C12H12ClF5O2 |
| Molecular Weight | 318.67 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 1-(2-chloro-4-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol |
| SMILES | OC(COCC(F)(F)C(F)F)Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C12H12ClF5O2/c13-10-4-8(14)2-1-7(10)3-9(19)5-20-6-12(17,18)11(15)16/h1-2,4,9,11,19H,3,5-6H2 |
| InChIKey | HAAFRZZBXSLFRU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.67 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|