C11H10Cl2F4O2 — CID 103474160
1-(2,5-dichlorophenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol (PubChem CID 103474160) has the molecular formula C11H10Cl2F4O2 and a molecular weight of 321.10 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol.
| Compound Name | 1-(2,5-dichlorophenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol |
|---|---|
| PubChem CID | 103474160 |
| Molecular Formula | C11H10Cl2F4O2 |
| Molecular Weight | 321.10 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol |
| SMILES | OC(COCC(F)(F)C(F)F)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H10Cl2F4O2/c12-6-1-2-8(13)7(3-6)9(18)4-19-5-11(16,17)10(14)15/h1-3,9-10,18H,4-5H2 |
| InChIKey | PTQXUUUKGNMZGH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.10 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|