C11H10ClF5O2 — CID 103473924
1-(4-chloro-2-fluorophenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol (PubChem CID 103473924) has the molecular formula C11H10ClF5O2 and a molecular weight of 304.64 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol |
|---|---|
| PubChem CID | 103473924 |
| Molecular Formula | C11H10ClF5O2 |
| Molecular Weight | 304.64 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol |
| SMILES | OC(COCC(F)(F)C(F)F)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C11H10ClF5O2/c12-6-1-2-7(8(13)3-6)9(18)4-19-5-11(16,17)10(14)15/h1-3,9-10,18H,4-5H2 |
| InChIKey | FZCBUWAWUFYVPA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.64 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|