C15H20F4O2 — CID 103474140
1-[3-(2-methylpropyl)phenyl]-2-(2,2,3,3-tetrafluoropropoxy)ethanol (PubChem CID 103474140) has the molecular formula C15H20F4O2 and a molecular weight of 308.32 g/mol. Its IUPAC name is 1-[3-(2-methylpropyl)phenyl]-2-(2,2,3,3-tetrafluoropropoxy)ethanol.
| Compound Name | 1-[3-(2-methylpropyl)phenyl]-2-(2,2,3,3-tetrafluoropropoxy)ethanol |
|---|---|
| PubChem CID | 103474140 |
| Molecular Formula | C15H20F4O2 |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 1-[3-(2-methylpropyl)phenyl]-2-(2,2,3,3-tetrafluoropropoxy)ethanol |
| SMILES | CC(C)Cc1cccc(C(O)COCC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C15H20F4O2/c1-10(2)6-11-4-3-5-12(7-11)13(20)8-21-9-15(18,19)14(16)17/h3-5,7,10,13-14,20H,6,8-9H2,1-2H3 |
| InChIKey | CQVJEXZMGHVZPX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|