C18H20F2O — CID 116542777
[4-(difluoromethyl)phenyl]-[3-(2-methylpropyl)phenyl]methanol (PubChem CID 116542777) has the molecular formula C18H20F2O and a molecular weight of 290.35 g/mol. Its IUPAC name is [4-(difluoromethyl)phenyl]-[3-(2-methylpropyl)phenyl]methanol.
| Compound Name | [4-(difluoromethyl)phenyl]-[3-(2-methylpropyl)phenyl]methanol |
|---|---|
| PubChem CID | 116542777 |
| Molecular Formula | C18H20F2O |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | [4-(difluoromethyl)phenyl]-[3-(2-methylpropyl)phenyl]methanol |
| SMILES | CC(C)Cc1cccc(C(O)c2ccc(C(F)F)cc2)c1 |
| InChI | InChI=1S/C18H20F2O/c1-12(2)10-13-4-3-5-16(11-13)17(21)14-6-8-15(9-7-14)18(19)20/h3-9,11-12,17-18,21H,10H2,1-2H3 |
| InChIKey | ATVFLLHYMRSWFR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |