C13H20O2 — CID 116543527
2-methoxy-1-[3-(2-methylpropyl)phenyl]ethanol (PubChem CID 116543527) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-methoxy-1-[3-(2-methylpropyl)phenyl]ethanol.
| Compound Name | 2-methoxy-1-[3-(2-methylpropyl)phenyl]ethanol |
|---|---|
| PubChem CID | 116543527 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 2-methoxy-1-[3-(2-methylpropyl)phenyl]ethanol |
| SMILES | COCC(O)c1cccc(CC(C)C)c1 |
| InChI | InChI=1S/C13H20O2/c1-10(2)7-11-5-4-6-12(8-11)13(14)9-15-3/h4-6,8,10,13-14H,7,9H2,1-3H3 |
| InChIKey | DYDMNAYYOQVQIX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |