C14H17F5O — CID 156764542
3,3,4,4,4-pentafluoro-1-[3-(2-methylpropyl)phenyl]butan-1-ol (PubChem CID 156764542) has the molecular formula C14H17F5O and a molecular weight of 296.28 g/mol. Its IUPAC name is 3,3,4,4,4-pentafluoro-1-[3-(2-methylpropyl)phenyl]butan-1-ol.
| Compound Name | 3,3,4,4,4-pentafluoro-1-[3-(2-methylpropyl)phenyl]butan-1-ol |
|---|---|
| PubChem CID | 156764542 |
| Molecular Formula | C14H17F5O |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 3,3,4,4,4-pentafluoro-1-[3-(2-methylpropyl)phenyl]butan-1-ol |
| SMILES | CC(C)Cc1cccc(C(O)CC(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F5O/c1-9(2)6-10-4-3-5-11(7-10)12(20)8-13(15,16)14(17,18)19/h3-5,7,9,12,20H,6,8H2,1-2H3 |
| InChIKey | ZHVVEOVDQFNRLJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|