C17H15F13O — CID 156765512
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-(3-propan-2-ylphenyl)octan-1-ol (PubChem CID 156765512) has the molecular formula C17H15F13O and a molecular weight of 482.28 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-(3-propan-2-ylphenyl)octan-1-ol.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-(3-propan-2-ylphenyl)octan-1-ol |
|---|---|
| PubChem CID | 156765512 |
| Molecular Formula | C17H15F13O |
| Molecular Weight | 482.28 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-(3-propan-2-ylphenyl)octan-1-ol |
| SMILES | CC(C)c1cccc(C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15F13O/c1-8(2)9-4-3-5-10(6-9)11(31)7-12(18,19)13(20,21)14(22,23)15(24,25)16(26,27)17(28,29)30/h3-6,8,11,31H,7H2,1-2H3 |
| InChIKey | VPCZCVDAMKVWOM-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.28 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|