C18H17F13O — CID 156764453
1-(4-tert-butylphenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-1-ol (PubChem CID 156764453) has the molecular formula C18H17F13O and a molecular weight of 496.31 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-1-ol.
| Compound Name | 1-(4-tert-butylphenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-1-ol |
|---|---|
| PubChem CID | 156764453 |
| Molecular Formula | C18H17F13O |
| Molecular Weight | 496.31 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-1-ol |
| SMILES | CC(C)(C)c1ccc(C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H17F13O/c1-12(2,3)10-6-4-9(5-7-10)11(32)8-13(19,20)14(21,22)15(23,24)16(25,26)17(27,28)18(29,30)31/h4-7,11,32H,8H2,1-3H3 |
| InChIKey | QGSIHFWPXABZEP-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.31 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|