C14H11F11O — CID 156764052
3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-(4-methylphenyl)heptan-1-ol (PubChem CID 156764052) has the molecular formula C14H11F11O and a molecular weight of 404.22 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-(4-methylphenyl)heptan-1-ol.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-(4-methylphenyl)heptan-1-ol |
|---|---|
| PubChem CID | 156764052 |
| Molecular Formula | C14H11F11O |
| Molecular Weight | 404.22 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-(4-methylphenyl)heptan-1-ol |
| SMILES | Cc1ccc(C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H11F11O/c1-7-2-4-8(5-3-7)9(26)6-10(15,16)11(17,18)12(19,20)13(21,22)14(23,24)25/h2-5,9,26H,6H2,1H3 |
| InChIKey | NQYXVZBQPMKOST-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.22 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|