C15H15F9O2 — CID 156766061
3,3,4,4,5,5,6,6,6-nonafluoro-1-(4-propoxyphenyl)hexan-1-ol (PubChem CID 156766061) has the molecular formula C15H15F9O2 and a molecular weight of 398.27 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,6-nonafluoro-1-(4-propoxyphenyl)hexan-1-ol.
| Compound Name | 3,3,4,4,5,5,6,6,6-nonafluoro-1-(4-propoxyphenyl)hexan-1-ol |
|---|---|
| PubChem CID | 156766061 |
| Molecular Formula | C15H15F9O2 |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 3,3,4,4,5,5,6,6,6-nonafluoro-1-(4-propoxyphenyl)hexan-1-ol |
| SMILES | CCCOc1ccc(C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H15F9O2/c1-2-7-26-10-5-3-9(4-6-10)11(25)8-12(16,17)13(18,19)14(20,21)15(22,23)24/h3-6,11,25H,2,7-8H2,1H3 |
| InChIKey | NBRDQQRROVPHFV-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|