C18H30O2 — CID 115795331
3,5,5-trimethyl-1-(4-propoxyphenyl)hexan-1-ol (PubChem CID 115795331) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 3,5,5-trimethyl-1-(4-propoxyphenyl)hexan-1-ol.
| Compound Name | 3,5,5-trimethyl-1-(4-propoxyphenyl)hexan-1-ol |
|---|---|
| PubChem CID | 115795331 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 3,5,5-trimethyl-1-(4-propoxyphenyl)hexan-1-ol |
| SMILES | CCCOc1ccc(C(O)CC(C)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H30O2/c1-6-11-20-16-9-7-15(8-10-16)17(19)12-14(2)13-18(3,4)5/h7-10,14,17,19H,6,11-13H2,1-5H3 |
| InChIKey | CYXXHRKHQJXIJM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |