C16H17F9O2 — CID 156764535
4,4,5,5,6,6,7,7,7-nonafluoro-2-(4-propoxyphenyl)heptan-2-ol (PubChem CID 156764535) has the molecular formula C16H17F9O2 and a molecular weight of 412.29 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,7-nonafluoro-2-(4-propoxyphenyl)heptan-2-ol.
| Compound Name | 4,4,5,5,6,6,7,7,7-nonafluoro-2-(4-propoxyphenyl)heptan-2-ol |
|---|---|
| PubChem CID | 156764535 |
| Molecular Formula | C16H17F9O2 |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 4,4,5,5,6,6,7,7,7-nonafluoro-2-(4-propoxyphenyl)heptan-2-ol |
| SMILES | CCCOc1ccc(C(C)(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H17F9O2/c1-3-8-27-11-6-4-10(5-7-11)12(2,26)9-13(17,18)14(19,20)15(21,22)16(23,24)25/h4-7,26H,3,8-9H2,1-2H3 |
| InChIKey | ISMKZPWZPGCFEB-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|