C15H10F14O — CID 156764661
4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-(4-fluorophenyl)nonan-2-ol (PubChem CID 156764661) has the molecular formula C15H10F14O and a molecular weight of 472.22 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-(4-fluorophenyl)nonan-2-ol.
| Compound Name | 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-(4-fluorophenyl)nonan-2-ol |
|---|---|
| PubChem CID | 156764661 |
| Molecular Formula | C15H10F14O |
| Molecular Weight | 472.22 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-(4-fluorophenyl)nonan-2-ol |
| SMILES | CC(O)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H10F14O/c1-9(30,7-2-4-8(16)5-3-7)6-10(17,18)11(19,20)12(21,22)13(23,24)14(25,26)15(27,28)29/h2-5,30H,6H2,1H3 |
| InChIKey | JRYNVRWXTVPRAR-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.22 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|