C18H15F7O — CID 156765464
4,4,5,5,6,6,6-heptafluoro-2-(4-phenylphenyl)hexan-2-ol (PubChem CID 156765464) has the molecular formula C18H15F7O and a molecular weight of 380.30 g/mol. Its IUPAC name is 4,4,5,5,6,6,6-heptafluoro-2-(4-phenylphenyl)hexan-2-ol.
| Compound Name | 4,4,5,5,6,6,6-heptafluoro-2-(4-phenylphenyl)hexan-2-ol |
|---|---|
| PubChem CID | 156765464 |
| Molecular Formula | C18H15F7O |
| Molecular Weight | 380.30 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 4,4,5,5,6,6,6-heptafluoro-2-(4-phenylphenyl)hexan-2-ol |
| SMILES | CC(O)(CC(F)(F)C(F)(F)C(F)(F)F)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15F7O/c1-15(26,11-16(19,20)17(21,22)18(23,24)25)14-9-7-13(8-10-14)12-5-3-2-4-6-12/h2-10,26H,11H2,1H3 |
| InChIKey | LUQVOZANUVQDGV-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.30 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|