C16H13F11O3 — CID 156763423
[2-(4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-hydroxyoctan-2-yl)phenyl] acetate (PubChem CID 156763423) has the molecular formula C16H13F11O3 and a molecular weight of 462.26 g/mol. Its IUPAC name is [2-(4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-hydroxyoctan-2-yl)phenyl] acetate.
| Compound Name | [2-(4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-hydroxyoctan-2-yl)phenyl] acetate |
|---|---|
| PubChem CID | 156763423 |
| Molecular Formula | C16H13F11O3 |
| Molecular Weight | 462.26 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | [2-(4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-hydroxyoctan-2-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(C)(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H13F11O3/c1-8(28)30-10-6-4-3-5-9(10)11(2,29)7-12(17,18)13(19,20)14(21,22)15(23,24)16(25,26)27/h3-6,29H,7H2,1-2H3 |
| InChIKey | YEUZJCIKLSDWIY-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.26 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|