C24H19F13O3 — CID 162347349
[2-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-3-hydroxy-2-phenyldecan-3-yl)phenyl] acetate (PubChem CID 162347349) has the molecular formula C24H19F13O3 and a molecular weight of 602.39 g/mol. Its IUPAC name is [2-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-3-hydroxy-2-phenyldecan-3-yl)phenyl] acetate.
| Compound Name | [2-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-3-hydroxy-2-phenyldecan-3-yl)phenyl] acetate |
|---|---|
| PubChem CID | 162347349 |
| Molecular Formula | C24H19F13O3 |
| Molecular Weight | 602.39 g/mol |
| Exact Mass | 602.11 |
| IUPAC Name | [2-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-3-hydroxy-2-phenyldecan-3-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(O)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(C)c1ccccc1 |
| InChI | InChI=1S/C24H19F13O3/c1-13(15-8-4-3-5-9-15)18(39,16-10-6-7-11-17(16)40-14(2)38)12-19(25,26)20(27,28)21(29,30)22(31,32)23(33,34)24(35,36)37/h3-11,13,39H,12H2,1-2H3 |
| InChIKey | OHFJSNFWFVJBAO-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.39 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|