C23H19F13O2 — CID 162347326
5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-3-(3-methoxyphenyl)-2-phenyldecan-3-ol (PubChem CID 162347326) has the molecular formula C23H19F13O2 and a molecular weight of 574.38 g/mol. Its IUPAC name is 5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-3-(3-methoxyphenyl)-2-phenyldecan-3-ol.
| Compound Name | 5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-3-(3-methoxyphenyl)-2-phenyldecan-3-ol |
|---|---|
| PubChem CID | 162347326 |
| Molecular Formula | C23H19F13O2 |
| Molecular Weight | 574.38 g/mol |
| Exact Mass | 574.12 |
| IUPAC Name | 5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-3-(3-methoxyphenyl)-2-phenyldecan-3-ol |
| SMILES | COc1cccc(C(O)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(C)c2ccccc2)c1 |
| InChI | InChI=1S/C23H19F13O2/c1-13(14-7-4-3-5-8-14)17(37,15-9-6-10-16(11-15)38-2)12-18(24,25)19(26,27)20(28,29)21(30,31)22(32,33)23(34,35)36/h3-11,13,37H,12H2,1-2H3 |
| InChIKey | UCOFCAQGENMFOL-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.38 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|